CAS 1062444-54-5 appears in our catalog under these names: 1V209, 1V209, 95%, 1V209/ 98.53% (existing batch purity), 1V209 98%, 4-((6-Amino-2-(2-methoxyethoxy)-8-oxo-7,8-dihydro-9H-purin-9-yl)methyl)benzoic acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Ambeed. Available pack sizes: 5mg, 250mg, 100mg, 1mg, 2mg, 10mg, 25mg, 50mg.
4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzoic acid (CAS 1062444-54-5) is a chemical compound with the molecular formula C16H17N5O5 and a molecular weight of 359.34 g/mol. IUPAC name: 4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzoic acid. InChIKey: ATISKRYGYNSRNP-UHFFFAOYSA-N.
| Molecular formula | C16H17N5O5 |
|---|---|
| Molecular weight | 359.34 g/mol |
| IUPAC name | 4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzoic acid |
| InChIKey | ATISKRYGYNSRNP-UHFFFAOYSA-N |
| SMILES | COCCOC1=NC(=C2C(=N1)N(C(=O)N2)CC3=CC=C(C=C3)C(=O)O)N |
Computed by PubChem (NCBI)