CAS 106261-64-7 appears in our catalog under these names: 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride, 95%, 4-((4-Methylpiperazin-1-yl)methyl)benzoyl Chloride Dihydrochloride, 4-((4-Methylpiperazin-1-yl)methyl)benzoyl chloride dihydrochloride, 97+%, 4-((4-Methylpiperazin-1-yl)methyl)benzoyl chloride dihydrochloride, 97+%, 97+%, Imatinib Impurity 17. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Chemat Brand. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, on request.
4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride (CAS 106261-64-7) is a chemical compound with the molecular formula C13H19Cl3N2O and a molecular weight of 325.7 g/mol. IUPAC name: 4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride. InChIKey: DDKLQZDSVJKYLJ-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl3N2O |
|---|---|
| Molecular weight | 325.7 g/mol |
| IUPAC name | 4-[(4-methylpiperazin-1-yl)methyl]benzoyl chloride;dihydrochloride |
| InChIKey | DDKLQZDSVJKYLJ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)C(=O)Cl.Cl.Cl |
Computed by PubChem (NCBI)