Products 1062669-34-4
CAS 1062669-34-4 is the registry number for 2-Chloro-N',4-dihydroxybenzene-1-carboximidamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-N',4-dihydroxybenzenecarboximidamide (CAS 1062669-34-4) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: 2-chloro-N',4-dihydroxybenzenecarboximidamide. InChIKey: CEWBKTSQXUFLOB-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-chloro-N',4-dihydroxybenzenecarboximidamide |
| InChIKey | CEWBKTSQXUFLOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Cl)/C(=N/O)/N |
Computed by PubChem (NCBI)