Products 106357-47-5
CAS 106357-47-5 is the registry number for 3-Caffeoyl-1,5-quinolactone(3-Caffeoyl-gamma-quinide). Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 250mg, 100mg.
(1,4-dihydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl) 3-(3,4-dihydroxyphenyl)prop-2-enoate (CAS 106357-47-5) is a chemical compound with the molecular formula C16H16O8 and a molecular weight of 336.29 g/mol. IUPAC name: (1,4-dihydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl) 3-(3,4-dihydroxyphenyl)prop-2-enoate. InChIKey: FXXATDNXMJKMSF-UHFFFAOYSA-N.
| Molecular formula | C16H16O8 |
|---|---|
| Molecular weight | 336.29 g/mol |
| IUPAC name | (1,4-dihydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl) 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| InChIKey | FXXATDNXMJKMSF-UHFFFAOYSA-N |
| SMILES | C1C2C(C(CC1(C(=O)O2)O)OC(=O)C=CC3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)