CAS 1063734-12-2 is the registry number for tert-butyl N-((1R,2R,4R)-rel-5-oxobicyclo(2.2.2)octan-2-yl)carbamate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl N-[(1R,2R,4R)-5-oxo-2-bicyclo[2.2.2]octanyl]carbamate (CAS 1063734-12-2) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: tert-butyl N-[(1R,2R,4R)-5-oxo-2-bicyclo[2.2.2]octanyl]carbamate. InChIKey: QPLFGDVZMUEZKT-OPRDCNLKSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R,4R)-5-oxo-2-bicyclo[2.2.2]octanyl]carbamate |
| InChIKey | QPLFGDVZMUEZKT-OPRDCNLKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]2CC[C@@H]1CC2=O |
Computed by PubChem (NCBI)