CAS 1064-10-4 appears in our catalog under these names: 1,1,1,2,2,2-Hexaphenyldistannane, 95%, Hexaphenylditin(IV). Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 250mg.
CAS 1064-10-4 identifies a chemical compound with the molecular formula C36H30Sn2 and a molecular weight of 700.0 g/mol. InChIKey: UAPQJVJCJITJET-UHFFFAOYSA-N.
| Molecular formula | C36H30Sn2 |
|---|---|
| Molecular weight | 700.0 g/mol |
| InChIKey | UAPQJVJCJITJET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)[Sn](C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)