CAS 1064366-80-8 is the registry number for (E)-5-(3,4-Dichlorobenzylidene)-2-mercaptothiazol-4(5H)-one, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
(5E)-5-[(3,4-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 1064366-80-8) is a chemical compound with the molecular formula C10H5Cl2NOS2 and a molecular weight of 290.2 g/mol. IUPAC name: (5E)-5-[(3,4-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: ZLJFJFLVZUHVOW-XBXARRHUSA-N.
| Molecular formula | C10H5Cl2NOS2 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | (5E)-5-[(3,4-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | ZLJFJFLVZUHVOW-XBXARRHUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/2\C(=O)NC(=S)S2)Cl)Cl |
Computed by PubChem (NCBI)