Products 106476-75-9
CAS 106476-75-9 appears in our catalog under these names: BNN6, N,N'-(1,4-PHENYLENE)BIS(N-(SEC-BUTYL)NITROUS AMIDE), 95%, 95%, BNN6, 98.0%, N，N'-(1，4-PHENYLENE)BIS(N-(SEC-BUTYL)NITROUS AMIDE), 98%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 5 mg, 10 mg.
N-butan-2-yl-N-[4-[butan-2-yl(nitroso)amino]phenyl]nitrous amide (CAS 106476-75-9) is a chemical compound with the molecular formula C14H22N4O2 and a molecular weight of 278.35 g/mol. IUPAC name: N-butan-2-yl-N-[4-[butan-2-yl(nitroso)amino]phenyl]nitrous amide. InChIKey: YLTBEWSTQZLPJS-UHFFFAOYSA-N.
| Molecular formula | C14H22N4O2 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | N-butan-2-yl-N-[4-[butan-2-yl(nitroso)amino]phenyl]nitrous amide |
| InChIKey | YLTBEWSTQZLPJS-UHFFFAOYSA-N |
| SMILES | CCC(C)N(C1=CC=C(C=C1)N(C(C)CC)N=O)N=O |
Computed by PubChem (NCBI)