CAS 106480-60-8 is the registry number for 3',5,5'-Trichlorosalicylanilide. Offered by: TRC, MedChemExpress. Available pack sizes: 10g, 1g, 1 g, 10 g, 100 mg.
5-chloro-N-(3,5-dichlorophenyl)-2-hydroxybenzamide (CAS 106480-60-8) is a chemical compound with the molecular formula C13H8Cl3NO2 and a molecular weight of 316.6 g/mol. IUPAC name: 5-chloro-N-(3,5-dichlorophenyl)-2-hydroxybenzamide. InChIKey: FJIIZNKTKISOBM-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl3NO2 |
|---|---|
| Molecular weight | 316.6 g/mol |
| IUPAC name | 5-chloro-N-(3,5-dichlorophenyl)-2-hydroxybenzamide |
| InChIKey | FJIIZNKTKISOBM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)NC2=CC(=CC(=C2)Cl)Cl)O |
Computed by PubChem (NCBI)