Products 106480-60-8

CAS 106480-60-8 is the registry number for 3',5,5'-Trichlorosalicylanilide. Offered by: TRC, MedChemExpress. Available pack sizes: 10g, 1g, 1 g, 10 g, 100 mg.

Structural formula: {0} (CAS {1})

5-chloro-N-(3,5-dichlorophenyl)-2-hydroxybenzamide (CAS 106480-60-8) is a chemical compound with the molecular formula C13H8Cl3NO2 and a molecular weight of 316.6 g/mol. IUPAC name: 5-chloro-N-(3,5-dichlorophenyl)-2-hydroxybenzamide. InChIKey: FJIIZNKTKISOBM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8Cl3NO2
Molecular weight316.6 g/mol
IUPAC name5-chloro-N-(3,5-dichlorophenyl)-2-hydroxybenzamide
InChIKeyFJIIZNKTKISOBM-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)C(=O)NC2=CC(=CC(=C2)Cl)Cl)O

Computed by PubChem (NCBI)