CAS 1065-49-2 is the registry number for Tetrakis(pentafluorophenyl)stannane, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tetrakis(2,3,4,5,6-pentafluorophenyl)stannane (CAS 1065-49-2) is a chemical compound with the molecular formula C24F20Sn and a molecular weight of 786.9 g/mol. IUPAC name: tetrakis(2,3,4,5,6-pentafluorophenyl)stannane. InChIKey: KSBKVGFAMLUKFL-UHFFFAOYSA-N.
| Molecular formula | C24F20Sn |
|---|---|
| Molecular weight | 786.9 g/mol |
| IUPAC name | tetrakis(2,3,4,5,6-pentafluorophenyl)stannane |
| InChIKey | KSBKVGFAMLUKFL-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)[Sn](C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F)F)F)F |
Computed by PubChem (NCBI)