CAS 1065074-85-2 is the registry number for 3-Bromo-N-cyclopropyl-5-nitropyridin-2-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
3-bromo-N-cyclopropyl-5-nitropyridin-2-amine (CAS 1065074-85-2) is a chemical compound with the molecular formula C8H8BrN3O2 and a molecular weight of 258.07 g/mol. IUPAC name: 3-bromo-N-cyclopropyl-5-nitropyridin-2-amine. InChIKey: QHJNUSLJEIVEHR-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3O2 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 3-bromo-N-cyclopropyl-5-nitropyridin-2-amine |
| InChIKey | QHJNUSLJEIVEHR-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=C(C=C(C=N2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)