CAS 1065075-49-1 is the registry number for tert-Butyl(chroman-4-yloxy)dimethylsilane, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl-(3,4-dihydro-2H-chromen-4-yloxy)-dimethylsilane (CAS 1065075-49-1) is a chemical compound with the molecular formula C15H24O2Si and a molecular weight of 264.43 g/mol. IUPAC name: tert-butyl-(3,4-dihydro-2H-chromen-4-yloxy)-dimethylsilane. InChIKey: YTVNAPSTIULIIC-UHFFFAOYSA-N.
| Molecular formula | C15H24O2Si |
|---|---|
| Molecular weight | 264.43 g/mol |
| IUPAC name | tert-butyl-(3,4-dihydro-2H-chromen-4-yloxy)-dimethylsilane |
| InChIKey | YTVNAPSTIULIIC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCOC2=CC=CC=C12 |
Computed by PubChem (NCBI)