Products 1065100-50-6
CAS 1065100-50-6 is the registry number for 6-Iodo-2-(trifluoromethyl)-1,4-dihydroquinolin-4-one, 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
6-iodo-2-(trifluoromethyl)-1H-quinolin-4-one (CAS 1065100-50-6) is a chemical compound with the molecular formula C10H5F3INO and a molecular weight of 339.05 g/mol. IUPAC name: 6-iodo-2-(trifluoromethyl)-1H-quinolin-4-one. InChIKey: MGVPAKBHXXRIEL-UHFFFAOYSA-N.
| Molecular formula | C10H5F3INO |
|---|---|
| Molecular weight | 339.05 g/mol |
| IUPAC name | 6-iodo-2-(trifluoromethyl)-1H-quinolin-4-one |
| InChIKey | MGVPAKBHXXRIEL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C(=O)C=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)