CAS 1065473-08-6 appears in our catalog under these names: 2-Chloropyrimidine-d3 (Major), 2-Chloropyrimidine-4,5,6-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 5 mg, 10 mg, 1 mg.
2-chloro-4,5,6-trideuteriopyrimidine (CAS 1065473-08-6) is a chemical compound with the molecular formula C4H3ClN2 and a molecular weight of 117.55 g/mol. IUPAC name: 2-chloro-4,5,6-trideuteriopyrimidine. InChIKey: UNCQVRBWJWWJBF-CBYSEHNBSA-N.
| Molecular formula | C4H3ClN2 |
|---|---|
| Molecular weight | 117.55 g/mol |
| IUPAC name | 2-chloro-4,5,6-trideuteriopyrimidine |
| InChIKey | UNCQVRBWJWWJBF-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(N=C(N=C1[2H])Cl)[2H] |
Computed by PubChem (NCBI)