CAS 106560-32-1 is the registry number for Faropenem Related Compound 1. Offered by: Chemat Brand. Available pack sizes: on request.
S-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] (2R)-oxolane-2-carbothioate (CAS 106560-32-1) is a chemical compound with the molecular formula C16H29NO4SSi and a molecular weight of 359.6 g/mol. IUPAC name: S-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] (2R)-oxolane-2-carbothioate. InChIKey: CYIYODQQOPTSEF-NRWUCQMLSA-N.
| Molecular formula | C16H29NO4SSi |
|---|---|
| Molecular weight | 359.6 g/mol |
| IUPAC name | S-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] (2R)-oxolane-2-carbothioate |
| InChIKey | CYIYODQQOPTSEF-NRWUCQMLSA-N |
| SMILES | C[C@H]([C@@H]1[C@H](NC1=O)SC(=O)[C@H]2CCCO2)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)