Products 106567-18-4
CAS 106567-18-4 is the registry number for 3-bromo-2,6-dimethoxy-N,N-dimethylbenzamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-bromo-2,6-dimethoxy-N,N-dimethylbenzamide (CAS 106567-18-4) is a chemical compound with the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. IUPAC name: 3-bromo-2,6-dimethoxy-N,N-dimethylbenzamide. InChIKey: HLMUDOFLGWGCCC-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO3 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 3-bromo-2,6-dimethoxy-N,N-dimethylbenzamide |
| InChIKey | HLMUDOFLGWGCCC-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1OC)Br)OC |
Computed by PubChem (NCBI)