CAS 106664-01-1 is the registry number for NSD2-PWWP1-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-methoxyphenyl)-1,2-benzoselenazol-3-one (CAS 106664-01-1) is a chemical compound with the molecular formula C14H11NO2Se and a molecular weight of 304.21 g/mol. IUPAC name: 2-(2-methoxyphenyl)-1,2-benzoselenazol-3-one. InChIKey: KKKQSDGDCNBMFN-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2Se |
|---|---|
| Molecular weight | 304.21 g/mol |
| IUPAC name | 2-(2-methoxyphenyl)-1,2-benzoselenazol-3-one |
| InChIKey | KKKQSDGDCNBMFN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2C(=O)C3=CC=CC=C3[Se]2 |
Computed by PubChem (NCBI)