Products 106689-24-1

CAS 106689-24-1 is the registry number for 9-Thiastearic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

8-nonylsulfanyloctanoic acid (CAS 106689-24-1) is a chemical compound with the molecular formula C17H34O2S and a molecular weight of 302.5 g/mol. IUPAC name: 8-nonylsulfanyloctanoic acid. InChIKey: IYDVFMFKIKZKEK-UHFFFAOYSA-N.

Identity
Molecular formulaC17H34O2S
Molecular weight302.5 g/mol
IUPAC name8-nonylsulfanyloctanoic acid
InChIKeyIYDVFMFKIKZKEK-UHFFFAOYSA-N
SMILESCCCCCCCCCSCCCCCCCC(=O)O

Computed by PubChem (NCBI)