Products 106705-37-7

CAS 106705-37-7 is the registry number for Strontium neodecanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 2g, 50g, 10g.

Structural formula: {0} (CAS {1})

Strontium bis(7,7-dimethyloctanoate) (CAS 106705-37-7) is a chemical compound with the molecular formula C20H38O4Sr and a molecular weight of 430.1 g/mol. IUPAC name: strontium bis(7,7-dimethyloctanoate). InChIKey: CSQXYUPPOWGAIS-UHFFFAOYSA-L.

Identity
Molecular formulaC20H38O4Sr
Molecular weight430.1 g/mol
IUPAC namestrontium bis(7,7-dimethyloctanoate)
InChIKeyCSQXYUPPOWGAIS-UHFFFAOYSA-L
SMILESCC(C)(C)CCCCCC(=O)[O-].CC(C)(C)CCCCCC(=O)[O-].[Sr+2]

Computed by PubChem (NCBI)