CAS 106705-37-7 is the registry number for Strontium neodecanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 2g, 50g, 10g.
Strontium bis(7,7-dimethyloctanoate) (CAS 106705-37-7) is a chemical compound with the molecular formula C20H38O4Sr and a molecular weight of 430.1 g/mol. IUPAC name: strontium bis(7,7-dimethyloctanoate). InChIKey: CSQXYUPPOWGAIS-UHFFFAOYSA-L.
| Molecular formula | C20H38O4Sr |
|---|---|
| Molecular weight | 430.1 g/mol |
| IUPAC name | strontium bis(7,7-dimethyloctanoate) |
| InChIKey | CSQXYUPPOWGAIS-UHFFFAOYSA-L |
| SMILES | CC(C)(C)CCCCCC(=O)[O-].CC(C)(C)CCCCCC(=O)[O-].[Sr+2] |
Computed by PubChem (NCBI)