CAS 1067187-97-6 appears in our catalog under these names: 5-Bromo-7-(trifluoromethyl)indoline-2,3-dione, 97%, 97%, 5-Bromo-7-(trifluoromethyl)indoline-2,3-dione, 98%, 5-Bromo-7-(trifluoromethyl)indoline-2,3-dione, 5-Bromo-7-(trifluoromethyl)indoline-2,3-dione, 97%. Offered by: Chemat, AmBeed, Biosynth, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
5-bromo-7-(trifluoromethyl)-1H-indole-2,3-dione (CAS 1067187-97-6) is a chemical compound with the molecular formula C9H3BrF3NO2 and a molecular weight of 294.02 g/mol. IUPAC name: 5-bromo-7-(trifluoromethyl)-1H-indole-2,3-dione. InChIKey: FUSDTCGITGSLPQ-UHFFFAOYSA-N.
| Molecular formula | C9H3BrF3NO2 |
|---|---|
| Molecular weight | 294.02 g/mol |
| IUPAC name | 5-bromo-7-(trifluoromethyl)-1H-indole-2,3-dione |
| InChIKey | FUSDTCGITGSLPQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)C(F)(F)F)Br |
Computed by PubChem (NCBI)