CAS 1067230-56-1 is the registry number for 4,4-Difluorocyclohexyl 4-methylbenzenesulfonate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
(4,4-difluorocyclohexyl) 4-methylbenzenesulfonate (CAS 1067230-56-1) is a chemical compound with the molecular formula C13H16F2O3S and a molecular weight of 290.33 g/mol. IUPAC name: (4,4-difluorocyclohexyl) 4-methylbenzenesulfonate. InChIKey: XEDFISYURDWFCL-UHFFFAOYSA-N.
| Molecular formula | C13H16F2O3S |
|---|---|
| Molecular weight | 290.33 g/mol |
| IUPAC name | (4,4-difluorocyclohexyl) 4-methylbenzenesulfonate |
| InChIKey | XEDFISYURDWFCL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CCC(CC2)(F)F |
Computed by PubChem (NCBI)