Products 1067660-91-6

CAS 1067660-91-6 is the registry number for N,N,N'-Trimethyl-n'-piperidin-4-ylpropane-1,3-diamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

N,N,N'-trimethyl-N'-piperidin-4-ylpropane-1,3-diamine (CAS 1067660-91-6) is a chemical compound with the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. IUPAC name: N,N,N'-trimethyl-N'-piperidin-4-ylpropane-1,3-diamine. InChIKey: CTQCSCBIGWYJBO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H25N3
Molecular weight199.34 g/mol
IUPAC nameN,N,N'-trimethyl-N'-piperidin-4-ylpropane-1,3-diamine
InChIKeyCTQCSCBIGWYJBO-UHFFFAOYSA-N
SMILESCN(C)CCCN(C)C1CCNCC1

Computed by PubChem (NCBI)