CAS 106776-17-4 appears in our catalog under these names: Trimethyl-d9-Sulfonium Iodide, Trimethyl-d9-sulfonium Iodide, >95% (HPLC), Trimethyl-d9-sulfonium Iodide, 99 atom % D, min 98% Chemical Purity, D9-Trimethylsulfonium iodide, Trimethylsulfonium-d9 (iodide). Offered by: Chemat Brand, TRC, CDN, HPC Standards, MedChemExpress. Available pack sizes: on request, 10mg, 50mg, 5mg, 0,5g, 0,25g, 1x10mg, 25 mg.
Tris(trideuteriomethyl)sulfanium iodide (CAS 106776-17-4) is a chemical compound with the molecular formula C3H9IS and a molecular weight of 213.13 g/mol. IUPAC name: tris(trideuteriomethyl)sulfanium iodide. InChIKey: VFJYIHQDILEQNR-KYRNGWDOSA-M.
| Molecular formula | C3H9IS |
|---|---|
| Molecular weight | 213.13 g/mol |
| IUPAC name | tris(trideuteriomethyl)sulfanium iodide |
| InChIKey | VFJYIHQDILEQNR-KYRNGWDOSA-M |
| SMILES | [2H]C([2H])([2H])[S+](C([2H])([2H])[2H])C([2H])([2H])[2H].[I-] |
Computed by PubChem (NCBI)