Products 1067884-45-0
CAS 1067884-45-0 is the registry number for MLS-2384 (free base). Offered by: MedChemExpress. Available pack sizes: Get quote.
6-bromo-3-[(3E)-3-(2-piperazin-1-ylethoxyimino)indol-2-yl]-1H-indol-2-ol (CAS 1067884-45-0) is a chemical compound with the molecular formula C22H22BrN5O2 and a molecular weight of 468.3 g/mol. IUPAC name: 6-bromo-3-[(3E)-3-(2-piperazin-1-ylethoxyimino)indol-2-yl]-1H-indol-2-ol. InChIKey: MQNSXNHCCSXFML-NHFJDJAPSA-N.
| Molecular formula | C22H22BrN5O2 |
|---|---|
| Molecular weight | 468.3 g/mol |
| IUPAC name | 6-bromo-3-[(3E)-3-(2-piperazin-1-ylethoxyimino)indol-2-yl]-1H-indol-2-ol |
| InChIKey | MQNSXNHCCSXFML-NHFJDJAPSA-N |
| SMILES | C1CN(CCN1)CCO/N=C/2\C3=CC=CC=C3N=C2C4=C(NC5=C4C=CC(=C5)Br)O |
Computed by PubChem (NCBI)