CAS 106791-37-1 appears in our catalog under these names: Triclabendazole Sulfone, Triclabendazole Sulfone, >95% (HPLC), Triclabendazole-sulfone, Triclabendazole sulfone, 5-Chloro-6-(2,3-dichlorophenoxy)-2-(methylsulfonyl)-1H-benzo[d]imidazole, 97%, 97%. Offered by: Chemat Brand, TRC, Mikromol, Dr. Ehrenstorfer, GLPBio. Available pack sizes: on request, 100mg, 10mg, 25mg, 4x25mg, 50mg, 250mg, 1x50mg.
6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfonyl-1H-benzimidazole (CAS 106791-37-1) is a chemical compound with the molecular formula C14H9Cl3N2O3S and a molecular weight of 391.7 g/mol. IUPAC name: 6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfonyl-1H-benzimidazole. InChIKey: ZEIHWBIRYIXBSV-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl3N2O3S |
|---|---|
| Molecular weight | 391.7 g/mol |
| IUPAC name | 6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfonyl-1H-benzimidazole |
| InChIKey | ZEIHWBIRYIXBSV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC2=CC(=C(C=C2N1)Cl)OC3=C(C(=CC=C3)Cl)Cl |
Computed by PubChem (NCBI)