CAS 1067966-63-5 appears in our catalog under these names: Methyltriphenylphosphonium Methylcarbonate, METHYLTRIPHENYLPHOSPHONIUM METHYLCARBON&. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 10g, 5G.
Methyl carbonate;methyl(triphenyl)phosphanium (CAS 1067966-63-5) is a chemical compound with the molecular formula C21H21O3P and a molecular weight of 352.4 g/mol. IUPAC name: methyl carbonate;methyl(triphenyl)phosphanium. InChIKey: FALLFMKOBMQQNQ-UHFFFAOYSA-M.
| Molecular formula | C21H21O3P |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | methyl carbonate;methyl(triphenyl)phosphanium |
| InChIKey | FALLFMKOBMQQNQ-UHFFFAOYSA-M |
| SMILES | COC(=O)[O-].C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)