CAS 1068-63-9 appears in our catalog under these names: Cesium oxalate, 95%, CESIUM OXALATE. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 5g.
Dicesium;oxalate (CAS 1068-63-9) is a chemical compound with the molecular formula C2Cs2O4 and a molecular weight of 353.83 g/mol. IUPAC name: dicesium;oxalate. InChIKey: HEQUOWMMDQTGCX-UHFFFAOYSA-L.
| Molecular formula | C2Cs2O4 |
|---|---|
| Molecular weight | 353.83 g/mol |
| IUPAC name | dicesium;oxalate |
| InChIKey | HEQUOWMMDQTGCX-UHFFFAOYSA-L |
| SMILES | C(=O)(C(=O)[O-])[O-].[Cs+].[Cs+] |
Computed by PubChem (NCBI)