CAS 1068160-64-4 is the registry number for (2-Isopropyl-7-methoxypyrazolo(1,5-a)pyridin-3-yl)boronic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
(7-methoxy-2-propan-2-ylpyrazolo[1,5-a]pyridin-3-yl)boronic acid (CAS 1068160-64-4) is a chemical compound with the molecular formula C11H15BN2O3 and a molecular weight of 234.06 g/mol. IUPAC name: (7-methoxy-2-propan-2-ylpyrazolo[1,5-a]pyridin-3-yl)boronic acid. InChIKey: DUEQOKJCUHTVNO-UHFFFAOYSA-N.
| Molecular formula | C11H15BN2O3 |
|---|---|
| Molecular weight | 234.06 g/mol |
| IUPAC name | (7-methoxy-2-propan-2-ylpyrazolo[1,5-a]pyridin-3-yl)boronic acid |
| InChIKey | DUEQOKJCUHTVNO-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC=C(N2N=C1C(C)C)OC)(O)O |
Computed by PubChem (NCBI)