Products 106854-80-2
CAS 106854-80-2 is the registry number for 2,2,2-Trifluoroethyl 2-Hydroxy-5-(2,2,2-trifluoroethoxy)benzoate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
2,2,2-trifluoroethyl 2-hydroxy-5-(2,2,2-trifluoroethoxy)benzoate (CAS 106854-80-2) is a chemical compound with the molecular formula C11H8F6O4 and a molecular weight of 318.17 g/mol. IUPAC name: 2,2,2-trifluoroethyl 2-hydroxy-5-(2,2,2-trifluoroethoxy)benzoate. InChIKey: NOMAMPLRWRQRDS-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O4 |
|---|---|
| Molecular weight | 318.17 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl 2-hydroxy-5-(2,2,2-trifluoroethoxy)benzoate |
| InChIKey | NOMAMPLRWRQRDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(F)(F)F)C(=O)OCC(F)(F)F)O |
Computed by PubChem (NCBI)