Products 1069046-00-9
CAS 1069046-00-9 appears in our catalog under these names: ASB 14780, ASB 14780, ASB 14780New, ASB14780, 99.58%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 10mM/1mL, 25 mg.
2-amino-2-(hydroxymethyl)propane-1,3-diol;3-[1-(4-phenoxyphenyl)-3-(2-phenylethyl)indol-5-yl]propanoic acid (CAS 1069046-00-9) is a chemical compound with the molecular formula C35H38N2O6 and a molecular weight of 582.7 g/mol. IUPAC name: 2-amino-2-(hydroxymethyl)propane-1,3-diol;3-[1-(4-phenoxyphenyl)-3-(2-phenylethyl)indol-5-yl]propanoic acid. InChIKey: MBPXGBINIINSEU-UHFFFAOYSA-N.
| Molecular formula | C35H38N2O6 |
|---|---|
| Molecular weight | 582.7 g/mol |
| IUPAC name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;3-[1-(4-phenoxyphenyl)-3-(2-phenylethyl)indol-5-yl]propanoic acid |
| InChIKey | MBPXGBINIINSEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CN(C3=C2C=C(C=C3)CCC(=O)O)C4=CC=C(C=C4)OC5=CC=CC=C5.C(C(CO)(CO)N)O |
Computed by PubChem (NCBI)