CAS 1069112-51-1 is the registry number for 4,6-Bis(4-nitrophenoxy)pyrimidine. Offered by: TRC. Available pack sizes: 100mg, 500mg, 50mg.
4,6-bis(4-nitrophenoxy)pyrimidine (CAS 1069112-51-1) is a chemical compound with the molecular formula C16H10N4O6 and a molecular weight of 354.27 g/mol. IUPAC name: 4,6-bis(4-nitrophenoxy)pyrimidine. InChIKey: LJKMKRGHNQFQBO-UHFFFAOYSA-N.
| Molecular formula | C16H10N4O6 |
|---|---|
| Molecular weight | 354.27 g/mol |
| IUPAC name | 4,6-bis(4-nitrophenoxy)pyrimidine |
| InChIKey | LJKMKRGHNQFQBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=CC(=NC=N2)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)