Products 107-57-3

CAS 107-57-3 is the registry number for 3-Chloro-2-hydroxypropanesulphonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-chloro-2-hydroxypropane-1-sulfonic acid (CAS 107-57-3) is a chemical compound with the molecular formula C3H7ClO4S and a molecular weight of 174.60 g/mol. IUPAC name: 3-chloro-2-hydroxypropane-1-sulfonic acid. InChIKey: DDLBHIIDBLGOTE-UHFFFAOYSA-N.

Identity
Molecular formulaC3H7ClO4S
Molecular weight174.60 g/mol
IUPAC name3-chloro-2-hydroxypropane-1-sulfonic acid
InChIKeyDDLBHIIDBLGOTE-UHFFFAOYSA-N
SMILESC(C(CCl)O)S(=O)(=O)O

Computed by PubChem (NCBI)