Products 1070-95-7
CAS 1070-95-7 is the registry number for Guanoctine (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,4,4-trimethylpentan-2-yl)guanidine;hydrochloride (CAS 1070-95-7) is a chemical compound with the molecular formula C9H22ClN3 and a molecular weight of 207.74 g/mol. IUPAC name: 2-(2,4,4-trimethylpentan-2-yl)guanidine;hydrochloride. InChIKey: QRFSLMLESAIOMB-UHFFFAOYSA-N.
| Molecular formula | C9H22ClN3 |
|---|---|
| Molecular weight | 207.74 g/mol |
| IUPAC name | 2-(2,4,4-trimethylpentan-2-yl)guanidine;hydrochloride |
| InChIKey | QRFSLMLESAIOMB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)N=C(N)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
GUANOCTINE HYDROCHLORIDE, Guanoctine HCl, Guanoctine hydrochloride [USAN], Guanidine, (1,1,3,3-tetramethylbutyl)-, monohydrochloride, (1,1,3,3-Tetramethylbutyl)guanidine monohydrochloride, Guanoctine hydrochloride (USAN), 1-(2,4,4-Trimethylpentan-2-yl)guanidine hydrochloride, 2-(2,4,4-trimethylpentan-2-yl)guanidine;hydrochloride, starbld0001534, Guanoctine (hydrochloride)