CAS 107017-68-5 is the registry number for Methanesulfonic acid 2-tert-butoxycarbonylamino-2-methyl-propyl ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
[2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate (CAS 107017-68-5) is a chemical compound with the molecular formula C10H21NO5S and a molecular weight of 267.34 g/mol. IUPAC name: [2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate. InChIKey: UOXOJYBBCUVRHC-UHFFFAOYSA-N.
| Molecular formula | C10H21NO5S |
|---|---|
| Molecular weight | 267.34 g/mol |
| IUPAC name | [2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
| InChIKey | UOXOJYBBCUVRHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)COS(=O)(=O)C |
Computed by PubChem (NCBI)