CAS 1070686-96-2 appears in our catalog under these names: 2-Chloro-1-(4-(trifluoromethyl)phenyl)ethan-1-ol, 2-Chloro-1-(4-(trifluoromethyl)phenyl)ethan-1-ol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
2-chloro-1-[4-(trifluoromethyl)phenyl]ethanol (CAS 1070686-96-2) is a chemical compound with the molecular formula C9H8ClF3O and a molecular weight of 224.61 g/mol. IUPAC name: 2-chloro-1-[4-(trifluoromethyl)phenyl]ethanol. InChIKey: BCEOMUNHBSIMFA-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3O |
|---|---|
| Molecular weight | 224.61 g/mol |
| IUPAC name | 2-chloro-1-[4-(trifluoromethyl)phenyl]ethanol |
| InChIKey | BCEOMUNHBSIMFA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CCl)O)C(F)(F)F |
Computed by PubChem (NCBI)