CAS 107090-98-2 appears in our catalog under these names: 2-Methyl-2-((trimethylsilyl)oxy)propanenitrile-d6, 2-Methyl-2-[(trimethylsilyl)oxy]propanenitrile-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 50 mg, 10 mg, 25 mg, 100 mg.
3,3,3-trideuterio-2-(trideuteriomethyl)-2-trimethylsilyloxypropanenitrile (CAS 107090-98-2) is a chemical compound with the molecular formula C7H15NOSi and a molecular weight of 163.32 g/mol. IUPAC name: 3,3,3-trideuterio-2-(trideuteriomethyl)-2-trimethylsilyloxypropanenitrile. InChIKey: JOWNMNFMYXUNHY-WFGJKAKNSA-N.
| Molecular formula | C7H15NOSi |
|---|---|
| Molecular weight | 163.32 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-(trideuteriomethyl)-2-trimethylsilyloxypropanenitrile |
| InChIKey | JOWNMNFMYXUNHY-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C#N)(C([2H])([2H])[2H])O[Si](C)(C)C |
Computed by PubChem (NCBI)