CAS 1071227-10-5 appears in our catalog under these names: 4'-([2,2':6',2''-Terpyridin]-4'-yl)-[1,1'-biphenyl]-4-amine, 98%, 4'-([2,2':6',2''-Terpyridin]-4'-yl)-[1,1'-biphenyl]-4-amine, 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 250mg, 1g.
4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]aniline (CAS 1071227-10-5) is a chemical compound with the molecular formula C27H20N4 and a molecular weight of 400.5 g/mol. IUPAC name: 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]aniline. InChIKey: QRSFMPAUATXILG-UHFFFAOYSA-N.
| Molecular formula | C27H20N4 |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | 4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]aniline |
| InChIKey | QRSFMPAUATXILG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=C(C=C4)C5=CC=C(C=C5)N |
Computed by PubChem (NCBI)