CAS 3054159-55-3 is the registry number for BChE-IN-38. Offered by: MedChemExpress. Available pack sizes: Get quote.
11-[(1-naphthalen-1-yltriazol-4-yl)methyl]benzo[b][1]benzazepine (CAS 3054159-55-3) is a chemical compound with the molecular formula C27H20N4 and a molecular weight of 400.5 g/mol. IUPAC name: 11-[(1-naphthalen-1-yltriazol-4-yl)methyl]benzo[b][1]benzazepine. InChIKey: HQJFCMDFLBHTLU-UHFFFAOYSA-N.
| Molecular formula | C27H20N4 |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | 11-[(1-naphthalen-1-yltriazol-4-yl)methyl]benzo[b][1]benzazepine |
| InChIKey | HQJFCMDFLBHTLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N3C=C(N=N3)CN4C5=CC=CC=C5C=CC6=CC=CC=C64 |
Computed by PubChem (NCBI)