CAS 1071346-94-5 is the registry number for 6-Methyl-1,3-benzothiazole-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-methyl-1,3-benzothiazole-2,4-diamine (CAS 1071346-94-5) is a chemical compound with the molecular formula C8H9N3S and a molecular weight of 179.24 g/mol. IUPAC name: 6-methyl-1,3-benzothiazole-2,4-diamine. InChIKey: ATMSLSAMHWYQBB-UHFFFAOYSA-N.
| Molecular formula | C8H9N3S |
|---|---|
| Molecular weight | 179.24 g/mol |
| IUPAC name | 6-methyl-1,3-benzothiazole-2,4-diamine |
| InChIKey | ATMSLSAMHWYQBB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)SC(=N2)N)N |
Computed by PubChem (NCBI)