Products 1071360-23-0
CAS 1071360-23-0 is the registry number for (2-Aminobenzo[d]thiazol-6-yl)(pyrrolidin-1-yl)methanone, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
(2-amino-1,3-benzothiazol-6-yl)-pyrrolidin-1-ylmethanone (CAS 1071360-23-0) is a chemical compound with the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. IUPAC name: (2-amino-1,3-benzothiazol-6-yl)-pyrrolidin-1-ylmethanone. InChIKey: VZBQNKTUVDZSCW-UHFFFAOYSA-N.
| Molecular formula | C12H13N3OS |
|---|---|
| Molecular weight | 247.32 g/mol |
| IUPAC name | (2-amino-1,3-benzothiazol-6-yl)-pyrrolidin-1-ylmethanone |
| InChIKey | VZBQNKTUVDZSCW-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C2=CC3=C(C=C2)N=C(S3)N |
Computed by PubChem (NCBI)