Products 1071592-60-3
CAS 1071592-60-3 is the registry number for 2,4-Di-tert-butylphenyl trifluoromethanesulfonate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 1g, 5g, 10g.
(2,4-ditert-butylphenyl) trifluoromethanesulfonate (CAS 1071592-60-3) is a chemical compound with the molecular formula C15H21F3O3S and a molecular weight of 338.4 g/mol. IUPAC name: (2,4-ditert-butylphenyl) trifluoromethanesulfonate. InChIKey: VXHZPQFQDNCPID-UHFFFAOYSA-N.
| Molecular formula | C15H21F3O3S |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | (2,4-ditert-butylphenyl) trifluoromethanesulfonate |
| InChIKey | VXHZPQFQDNCPID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OS(=O)(=O)C(F)(F)F)C(C)(C)C |
Computed by PubChem (NCBI)