Products 1071809-48-7
CAS 1071809-48-7 appears in our catalog under these names: 4-Fluorobenzyl-d6 Alcohol, 98 atom % D, min 98% Chemical Purity, (4–fluorophenyl–2，3，5，6–d4)methan–d2–ol, (4-Fluorophenyl)methanol-d6. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 100mg, 10mg, 1 mg.
Dideuterio-(2,3,5,6-tetradeuterio-4-fluorophenyl)methanol (CAS 1071809-48-7) is a chemical compound with the molecular formula C7H7FO and a molecular weight of 132.16 g/mol. IUPAC name: dideuterio-(2,3,5,6-tetradeuterio-4-fluorophenyl)methanol. InChIKey: GEZMEIHVFSWOCA-NVSFMWKBSA-N.
| Molecular formula | C7H7FO |
|---|---|
| Molecular weight | 132.16 g/mol |
| IUPAC name | dideuterio-(2,3,5,6-tetradeuterio-4-fluorophenyl)methanol |
| InChIKey | GEZMEIHVFSWOCA-NVSFMWKBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])O)[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)