Products 1071809-52-3
CAS 1071809-52-3 appears in our catalog under these names: 4-Fluorobenzoyl-d4 Chloride, 98 atom % D, min 98% Chemical Purity, 4-Fluorobenzoyl-2,3,5,6-d4 chloride, 98.01%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 50 mg, 5 mg, 10 mg, 100 mg, 25 mg.
2,3,5,6-tetradeuterio-4-fluorobenzoyl chloride (CAS 1071809-52-3) is a chemical compound with the molecular formula C7H4ClFO and a molecular weight of 162.58 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-fluorobenzoyl chloride. InChIKey: CZKLEJHVLCMVQR-RHQRLBAQSA-N.
| Molecular formula | C7H4ClFO |
|---|---|
| Molecular weight | 162.58 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-fluorobenzoyl chloride |
| InChIKey | CZKLEJHVLCMVQR-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)Cl)[2H])[2H])F)[2H] |
Computed by PubChem (NCBI)