CAS 107189-96-8 is the registry number for MS 857. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-acetyl-1-methyl-7-pyridin-4-yl-5,6,7,8-tetrahydro-2H-isoquinolin-3-one (CAS 107189-96-8) is a chemical compound with the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. IUPAC name: 4-acetyl-1-methyl-7-pyridin-4-yl-5,6,7,8-tetrahydro-2H-isoquinolin-3-one. InChIKey: NVTWQACIVZHUPA-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O2 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | 4-acetyl-1-methyl-7-pyridin-4-yl-5,6,7,8-tetrahydro-2H-isoquinolin-3-one |
| InChIKey | NVTWQACIVZHUPA-UHFFFAOYSA-N |
| SMILES | CC1=C2CC(CCC2=C(C(=O)N1)C(=O)C)C3=CC=NC=C3 |
Computed by PubChem (NCBI)