Products 1071966-17-0
CAS 1071966-17-0 is the registry number for BaENR-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-2-(2-nitrophenoxy)phenol (CAS 1071966-17-0) is a chemical compound with the molecular formula C12H8ClNO4 and a molecular weight of 265.65 g/mol. IUPAC name: 5-chloro-2-(2-nitrophenoxy)phenol. InChIKey: COIDXTLVJPMZNP-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO4 |
|---|---|
| Molecular weight | 265.65 g/mol |
| IUPAC name | 5-chloro-2-(2-nitrophenoxy)phenol |
| InChIKey | COIDXTLVJPMZNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC2=C(C=C(C=C2)Cl)O |
Computed by PubChem (NCBI)