CAS 1072-12-4 appears in our catalog under these names: Hydrazinecarbothioamide,2,2'–(1,2–ethanediylidene)bis–, 2,2'-(Ethane-1,2-diylidene)bis(hydrazinecarbothioamide) 95%, 2,2'-(Ethane-1,2-diylidene)bis(hydrazinecarbothioamide), 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g.
[(E)-[(2E)-2-(carbamothioylhydrazinylidene)ethylidene]amino]thiourea (CAS 1072-12-4) is a chemical compound with the molecular formula C4H8N6S2 and a molecular weight of 204.3 g/mol. IUPAC name: [(E)-[(2E)-2-(carbamothioylhydrazinylidene)ethylidene]amino]thiourea. InChIKey: BZKLDUBXTMDNMW-FACPPWRESA-N.
| Molecular formula | C4H8N6S2 |
|---|---|
| Molecular weight | 204.3 g/mol |
| IUPAC name | [(E)-[(2E)-2-(carbamothioylhydrazinylidene)ethylidene]amino]thiourea |
| InChIKey | BZKLDUBXTMDNMW-FACPPWRESA-N |
| SMILES | C(=N/NC(=S)N)\C=N\NC(=S)N |
Computed by PubChem (NCBI)