CAS 1072344-63-8 is the registry number for (S)-Ethyl 4,4-difluoro-1-((r)-1-phenylethyl)piperidine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
Ethyl (2S)-4,4-difluoro-1-[(1R)-1-phenylethyl]piperidine-2-carboxylate (CAS 1072344-63-8) is a chemical compound with the molecular formula C16H21F2NO2 and a molecular weight of 297.34 g/mol. IUPAC name: ethyl (2S)-4,4-difluoro-1-[(1R)-1-phenylethyl]piperidine-2-carboxylate. InChIKey: CVCWYZPJDAJMTP-OCCSQVGLSA-N.
| Molecular formula | C16H21F2NO2 |
|---|---|
| Molecular weight | 297.34 g/mol |
| IUPAC name | ethyl (2S)-4,4-difluoro-1-[(1R)-1-phenylethyl]piperidine-2-carboxylate |
| InChIKey | CVCWYZPJDAJMTP-OCCSQVGLSA-N |
| SMILES | CCOC(=O)[C@@H]1CC(CCN1[C@H](C)C2=CC=CC=C2)(F)F |
Computed by PubChem (NCBI)