CAS 107264-00-6 appears in our catalog under these names: 1-Fluoro-2,4,6-trimethylpyridinium trifluoromethanesulfonate, 1-Fluoro-2,4,6-trimethylpyridinium triflate, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 0,5g, 1g, 2g, 5g, 100mg, 250mg, 25g.
1-fluoro-2,4,6-trimethylpyridin-1-ium;trifluoromethanesulfonate (CAS 107264-00-6) is a chemical compound with the molecular formula C9H11F4NO3S and a molecular weight of 289.25 g/mol. IUPAC name: 1-fluoro-2,4,6-trimethylpyridin-1-ium;trifluoromethanesulfonate. InChIKey: PRIGFEJKMMRJSF-UHFFFAOYSA-M.
| Molecular formula | C9H11F4NO3S |
|---|---|
| Molecular weight | 289.25 g/mol |
| IUPAC name | 1-fluoro-2,4,6-trimethylpyridin-1-ium;trifluoromethanesulfonate |
| InChIKey | PRIGFEJKMMRJSF-UHFFFAOYSA-M |
| SMILES | CC1=CC(=[N+](C(=C1)C)F)C.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)