CAS 1072807-15-8 is the registry number for Phenylbutyl isoselenocyanate. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-isoselenocyanatobutylbenzene (CAS 1072807-15-8) is a chemical compound with the molecular formula C11H13NSe and a molecular weight of 238.20 g/mol. IUPAC name: 4-isoselenocyanatobutylbenzene. InChIKey: NMPQIJIERCLTOG-UHFFFAOYSA-N.
| Molecular formula | C11H13NSe |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | 4-isoselenocyanatobutylbenzene |
| InChIKey | NMPQIJIERCLTOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCCN=C=[Se] |
Computed by PubChem (NCBI)