CAS 1072944-28-5 is the registry number for 4-Chlorobenzonitrile-2,5-diboronic acid neopentyl glycol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-chloro-2,5-bis(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile (CAS 1072944-28-5) is a chemical compound with the molecular formula C17H22B2ClNO4 and a molecular weight of 361.4 g/mol. IUPAC name: 4-chloro-2,5-bis(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile. InChIKey: QJVLPNSCIQJOBO-UHFFFAOYSA-N.
| Molecular formula | C17H22B2ClNO4 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 4-chloro-2,5-bis(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzonitrile |
| InChIKey | QJVLPNSCIQJOBO-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=C(C=C2Cl)B3OCC(CO3)(C)C)C#N |
Computed by PubChem (NCBI)